Start work on creating gpui2 version of project panel (#3299)

Max Brunsfeld created

I'm gonna land what I have, even though some features aren't ported yet,
since we're working on all of this code so actively.

* [x] get the basic structure compiling
* [x] get the panel laying out correctly
* [ ] rename / new file editor
* [ ] enable the tests
* [ ] drag and drop
* [ ] context menu

Change summary

Cargo.lock                                          |  31 
Cargo.toml                                          |   1 
crates/gpui2/src/color.rs                           |  11 
crates/project_panel2/Cargo.toml                    |  41 +
crates/project_panel2/src/file_associations.rs      |  96 +++
crates/project_panel2/src/project_panel.rs          | 418 ++++++------
crates/project_panel2/src/project_panel_settings.rs |  45 +
crates/settings2/src/keymap_file.rs                 |   6 
crates/workspace2/src/dock.rs                       |  20 
crates/workspace2/src/workspace2.rs                 | 475 +++++---------
crates/zed2/Cargo.toml                              |   2 
crates/zed2/src/main.rs                             |   2 
crates/zed2/src/zed2.rs                             |  62 -
13 files changed, 652 insertions(+), 558 deletions(-)

Detailed changes

Cargo.lock 🔗

@@ -6608,6 +6608,36 @@ dependencies = [
  "workspace",
 ]
 
+[[package]]
+name = "project_panel2"
+version = "0.1.0"
+dependencies = [
+ "anyhow",
+ "client2",
+ "collections",
+ "context_menu",
+ "db2",
+ "editor2",
+ "futures 0.3.28",
+ "gpui2",
+ "language2",
+ "menu2",
+ "postage",
+ "pretty_assertions",
+ "project2",
+ "schemars",
+ "serde",
+ "serde_derive",
+ "serde_json",
+ "settings2",
+ "smallvec",
+ "theme2",
+ "ui2",
+ "unicase",
+ "util",
+ "workspace2",
+]
+
 [[package]]
 name = "project_symbols"
 version = "0.1.0"
@@ -11417,6 +11447,7 @@ dependencies = [
  "parking_lot 0.11.2",
  "postage",
  "project2",
+ "project_panel2",
  "rand 0.8.5",
  "regex",
  "rope2",

Cargo.toml 🔗

@@ -80,6 +80,7 @@ members = [
     "crates/project",
     "crates/project2",
     "crates/project_panel",
+    "crates/project_panel2",
     "crates/project_symbols",
     "crates/recent_projects",
     "crates/rope",

crates/gpui2/src/color.rs 🔗

@@ -293,7 +293,16 @@ pub fn blue() -> Hsla {
 
 pub fn green() -> Hsla {
     Hsla {
-        h: 0.3,
+        h: 0.33,
+        s: 1.,
+        l: 0.5,
+        a: 1.,
+    }
+}
+
+pub fn yellow() -> Hsla {
+    Hsla {
+        h: 0.16,
         s: 1.,
         l: 0.5,
         a: 1.,

crates/project_panel2/Cargo.toml 🔗

@@ -0,0 +1,41 @@
+[package]
+name = "project_panel2"
+version = "0.1.0"
+edition = "2021"
+publish = false
+
+[lib]
+path = "src/project_panel.rs"
+doctest = false
+
+[dependencies]
+context_menu = { path = "../context_menu" }
+collections = { path = "../collections" }
+db = { path = "../db2", package = "db2" }
+editor = { path = "../editor2", package = "editor2" }
+gpui = { path = "../gpui2", package = "gpui2" }
+menu = { path = "../menu2", package = "menu2" }
+project = { path = "../project2", package = "project2" }
+settings = { path = "../settings2", package = "settings2" }
+theme = { path = "../theme2", package = "theme2" }
+ui = { path = "../ui2", package = "ui2" }
+util = { path = "../util" }
+workspace = { path = "../workspace2", package = "workspace2" }
+anyhow.workspace = true
+postage.workspace = true
+futures.workspace = true
+serde.workspace = true
+serde_derive.workspace = true
+serde_json.workspace = true
+schemars.workspace = true
+smallvec.workspace = true
+pretty_assertions.workspace = true
+unicase = "2.6"
+
+[dev-dependencies]
+client = { path = "../client2", package = "client2", features = ["test-support"] }
+language = { path = "../language2", package = "language2", features = ["test-support"] }
+editor = { path = "../editor2", package = "editor2", features = ["test-support"] }
+gpui = { path = "../gpui2", package = "gpui2", features = ["test-support"] }
+workspace = { path = "../workspace2", package = "workspace2", features = ["test-support"] }
+serde_json.workspace = true

crates/project_panel2/src/file_associations.rs 🔗

@@ -0,0 +1,96 @@
+use std::{path::Path, str, sync::Arc};
+
+use collections::HashMap;
+
+use gpui::{AppContext, AssetSource};
+use serde_derive::Deserialize;
+use util::{maybe, paths::PathExt};
+
+#[derive(Deserialize, Debug)]
+struct TypeConfig {
+    icon: Arc<str>,
+}
+
+#[derive(Deserialize, Debug)]
+pub struct FileAssociations {
+    suffixes: HashMap<String, String>,
+    types: HashMap<String, TypeConfig>,
+}
+
+const COLLAPSED_DIRECTORY_TYPE: &'static str = "collapsed_folder";
+const EXPANDED_DIRECTORY_TYPE: &'static str = "expanded_folder";
+const COLLAPSED_CHEVRON_TYPE: &'static str = "collapsed_chevron";
+const EXPANDED_CHEVRON_TYPE: &'static str = "expanded_chevron";
+pub const FILE_TYPES_ASSET: &'static str = "icons/file_icons/file_types.json";
+
+pub fn init(assets: impl AssetSource, cx: &mut AppContext) {
+    cx.set_global(FileAssociations::new(assets))
+}
+
+impl FileAssociations {
+    pub fn new(assets: impl AssetSource) -> Self {
+        assets
+            .load("icons/file_icons/file_types.json")
+            .and_then(|file| {
+                serde_json::from_str::<FileAssociations>(str::from_utf8(&file).unwrap())
+                    .map_err(Into::into)
+            })
+            .unwrap_or_else(|_| FileAssociations {
+                suffixes: HashMap::default(),
+                types: HashMap::default(),
+            })
+    }
+
+    pub fn get_icon(path: &Path, cx: &AppContext) -> Arc<str> {
+        maybe!({
+            let this = cx.has_global::<Self>().then(|| cx.global::<Self>())?;
+
+            // FIXME: Associate a type with the languages and have the file's langauge
+            //        override these associations
+            maybe!({
+                let suffix = path.icon_suffix()?;
+
+                this.suffixes
+                    .get(suffix)
+                    .and_then(|type_str| this.types.get(type_str))
+                    .map(|type_config| type_config.icon.clone())
+            })
+            .or_else(|| this.types.get("default").map(|config| config.icon.clone()))
+        })
+        .unwrap_or_else(|| Arc::from("".to_string()))
+    }
+
+    pub fn get_folder_icon(expanded: bool, cx: &AppContext) -> Arc<str> {
+        maybe!({
+            let this = cx.has_global::<Self>().then(|| cx.global::<Self>())?;
+
+            let key = if expanded {
+                EXPANDED_DIRECTORY_TYPE
+            } else {
+                COLLAPSED_DIRECTORY_TYPE
+            };
+
+            this.types
+                .get(key)
+                .map(|type_config| type_config.icon.clone())
+        })
+        .unwrap_or_else(|| Arc::from("".to_string()))
+    }
+
+    pub fn get_chevron_icon(expanded: bool, cx: &AppContext) -> Arc<str> {
+        maybe!({
+            let this = cx.has_global::<Self>().then(|| cx.global::<Self>())?;
+
+            let key = if expanded {
+                EXPANDED_CHEVRON_TYPE
+            } else {
+                COLLAPSED_CHEVRON_TYPE
+            };
+
+            this.types
+                .get(key)
+                .map(|type_config| type_config.icon.clone())
+        })
+        .unwrap_or_else(|| Arc::from("".to_string()))
+    }
+}

crates/project_panel2/src/project_panel.rs 🔗

@@ -8,10 +8,10 @@ use file_associations::FileAssociations;
 
 use anyhow::{anyhow, Result};
 use gpui::{
-    actions, div, px, svg, uniform_list, Action, AppContext, AssetSource, AsyncAppContext,
-    AsyncWindowContext, ClipboardItem, Div, Element, Entity, EventEmitter, FocusEnabled,
-    FocusHandle, Model, ParentElement as _, Pixels, Point, PromptLevel, Render,
-    StatefulInteractive, StatefulInteractivity, Styled, Task, UniformListScrollHandle, View,
+    actions, div, px, rems, svg, uniform_list, Action, AppContext, AssetSource, AsyncWindowContext,
+    ClipboardItem, Component, Div, EventEmitter, FocusHandle, FocusableKeyDispatch, Model,
+    MouseButton, ParentElement as _, Pixels, Point, PromptLevel, Render, StatefulInteractive,
+    StatefulInteractivity, StatelessInteractive, Styled, Task, UniformListScrollHandle, View,
     ViewContext, VisualContext as _, WeakView, WindowContext,
 };
 use menu::{Confirm, SelectNext, SelectPrev};
@@ -31,9 +31,9 @@ use std::{
     sync::Arc,
 };
 use theme::ActiveTheme as _;
-use ui::{h_stack, v_stack};
+use ui::{h_stack, v_stack, Label};
 use unicase::UniCase;
-use util::TryFutureExt;
+use util::{maybe, TryFutureExt};
 use workspace::{
     dock::{DockPosition, PanelEvent},
     Workspace,
@@ -54,8 +54,8 @@ pub struct ProjectPanel {
     edit_state: Option<EditState>,
     filename_editor: View<Editor>,
     clipboard_entry: Option<ClipboardEntry>,
-    dragged_entry_destination: Option<Arc<Path>>,
-    workspace: WeakView<Workspace>,
+    _dragged_entry_destination: Option<Arc<Path>>,
+    _workspace: WeakView<Workspace>,
     has_focus: bool,
     width: Option<f32>,
     pending_serialization: Task<Option<()>>,
@@ -131,31 +131,6 @@ pub fn init_settings(cx: &mut AppContext) {
 pub fn init(assets: impl AssetSource, cx: &mut AppContext) {
     init_settings(cx);
     file_associations::init(assets, cx);
-
-    // cx.add_action(ProjectPanel::expand_selected_entry);
-    // cx.add_action(ProjectPanel::collapse_selected_entry);
-    // cx.add_action(ProjectPanel::collapse_all_entries);
-    // cx.add_action(ProjectPanel::select_prev);
-    // cx.add_action(ProjectPanel::select_next);
-    // cx.add_action(ProjectPanel::new_file);
-    // cx.add_action(ProjectPanel::new_directory);
-    // cx.add_action(ProjectPanel::rename);
-    // cx.add_async_action(ProjectPanel::delete);
-    // cx.add_async_action(ProjectPanel::confirm);
-    // cx.add_async_action(ProjectPanel::open_file);
-    // cx.add_action(ProjectPanel::cancel);
-    // cx.add_action(ProjectPanel::cut);
-    // cx.add_action(ProjectPanel::copy);
-    // cx.add_action(ProjectPanel::copy_path);
-    // cx.add_action(ProjectPanel::copy_relative_path);
-    // cx.add_action(ProjectPanel::reveal_in_finder);
-    // cx.add_action(ProjectPanel::open_in_terminal);
-    // cx.add_action(ProjectPanel::new_search_in_directory);
-    // cx.add_action(
-    //     |this: &mut ProjectPanel, action: &Paste, cx: &mut ViewContext<ProjectPanel>| {
-    //         this.paste(action, cx);
-    //     },
-    // );
 }
 
 #[derive(Debug)]
@@ -244,7 +219,6 @@ impl ProjectPanel {
             // })
             // .detach();
 
-            let view_id = cx.view().entity_id();
             let mut this = Self {
                 project: project.clone(),
                 fs: workspace.app_state().fs.clone(),
@@ -258,8 +232,8 @@ impl ProjectPanel {
                 filename_editor,
                 clipboard_entry: None,
                 // context_menu: cx.add_view(|cx| ContextMenu::new(view_id, cx)),
-                dragged_entry_destination: None,
-                workspace: workspace.weak_handle(),
+                _dragged_entry_destination: None,
+                _workspace: workspace.weak_handle(),
                 has_focus: false,
                 width: None,
                 pending_serialization: Task::ready(None),
@@ -311,19 +285,19 @@ impl ProjectPanel {
                     }
                 }
                 &Event::SplitEntry { entry_id } => {
-                    // if let Some(worktree) = project.read(cx).worktree_for_entry(entry_id, cx) {
-                    //     if let Some(entry) = worktree.read(cx).entry_for_id(entry_id) {
-                    //         workspace
-                    //             .split_path(
-                    //                 ProjectPath {
-                    //                     worktree_id: worktree.read(cx).id(),
-                    //                     path: entry.path.clone(),
-                    //                 },
-                    //                 cx,
-                    //             )
-                    //             .detach_and_log_err(cx);
-                    //     }
-                    // }
+                    if let Some(worktree) = project.read(cx).worktree_for_entry(entry_id, cx) {
+                        if let Some(_entry) = worktree.read(cx).entry_for_id(entry_id) {
+                            // workspace
+                            //     .split_path(
+                            //         ProjectPath {
+                            //             worktree_id: worktree.read(cx).id(),
+                            //             path: entry.path.clone(),
+                            //         },
+                            //         cx,
+                            //     )
+                            //     .detach_and_log_err(cx);
+                        }
+                    }
                 }
                 _ => {}
             }
@@ -391,79 +365,80 @@ impl ProjectPanel {
 
     fn deploy_context_menu(
         &mut self,
-        position: Point<Pixels>,
-        entry_id: ProjectEntryId,
-        cx: &mut ViewContext<Self>,
+        _position: Point<Pixels>,
+        _entry_id: ProjectEntryId,
+        _cx: &mut ViewContext<Self>,
     ) {
-        // let project = self.project.read(cx);
-
-        // let worktree_id = if let Some(id) = project.worktree_id_for_entry(entry_id, cx) {
-        //     id
-        // } else {
-        //     return;
-        // };
+        todo!()
+        //     let project = self.project.read(cx);
 
-        // self.selection = Some(Selection {
-        //     worktree_id,
-        //     entry_id,
-        // });
+        //     let worktree_id = if let Some(id) = project.worktree_id_for_entry(entry_id, cx) {
+        //         id
+        //     } else {
+        //         return;
+        //     };
 
-        // let mut menu_entries = Vec::new();
-        // if let Some((worktree, entry)) = self.selected_entry(cx) {
-        //     let is_root = Some(entry) == worktree.root_entry();
-        //     if !project.is_remote() {
-        //         menu_entries.push(ContextMenuItem::action(
-        //             "Add Folder to Project",
-        //             workspace::AddFolderToProject,
-        //         ));
-        //         if is_root {
-        //             let project = self.project.clone();
-        //             menu_entries.push(ContextMenuItem::handler("Remove from Project", move |cx| {
-        //                 project.update(cx, |project, cx| project.remove_worktree(worktree_id, cx));
-        //             }));
+        //     self.selection = Some(Selection {
+        //         worktree_id,
+        //         entry_id,
+        //     });
+
+        //     let mut menu_entries = Vec::new();
+        //     if let Some((worktree, entry)) = self.selected_entry(cx) {
+        //         let is_root = Some(entry) == worktree.root_entry();
+        //         if !project.is_remote() {
+        //             menu_entries.push(ContextMenuItem::action(
+        //                 "Add Folder to Project",
+        //                 workspace::AddFolderToProject,
+        //             ));
+        //             if is_root {
+        //                 let project = self.project.clone();
+        //                 menu_entries.push(ContextMenuItem::handler("Remove from Project", move |cx| {
+        //                     project.update(cx, |project, cx| project.remove_worktree(worktree_id, cx));
+        //                 }));
+        //             }
         //         }
-        //     }
-        //     menu_entries.push(ContextMenuItem::action("New File", NewFile));
-        //     menu_entries.push(ContextMenuItem::action("New Folder", NewDirectory));
-        //     menu_entries.push(ContextMenuItem::Separator);
-        //     menu_entries.push(ContextMenuItem::action("Cut", Cut));
-        //     menu_entries.push(ContextMenuItem::action("Copy", Copy));
-        //     if let Some(clipboard_entry) = self.clipboard_entry {
-        //         if clipboard_entry.worktree_id() == worktree.id() {
-        //             menu_entries.push(ContextMenuItem::action("Paste", Paste));
+        //         menu_entries.push(ContextMenuItem::action("New File", NewFile));
+        //         menu_entries.push(ContextMenuItem::action("New Folder", NewDirectory));
+        //         menu_entries.push(ContextMenuItem::Separator);
+        //         menu_entries.push(ContextMenuItem::action("Cut", Cut));
+        //         menu_entries.push(ContextMenuItem::action("Copy", Copy));
+        //         if let Some(clipboard_entry) = self.clipboard_entry {
+        //             if clipboard_entry.worktree_id() == worktree.id() {
+        //                 menu_entries.push(ContextMenuItem::action("Paste", Paste));
+        //             }
         //         }
-        //     }
-        //     menu_entries.push(ContextMenuItem::Separator);
-        //     menu_entries.push(ContextMenuItem::action("Copy Path", CopyPath));
-        //     menu_entries.push(ContextMenuItem::action(
-        //         "Copy Relative Path",
-        //         CopyRelativePath,
-        //     ));
-
-        //     if entry.is_dir() {
         //         menu_entries.push(ContextMenuItem::Separator);
-        //     }
-        //     menu_entries.push(ContextMenuItem::action("Reveal in Finder", RevealInFinder));
-        //     if entry.is_dir() {
-        //         menu_entries.push(ContextMenuItem::action("Open in Terminal", OpenInTerminal));
+        //         menu_entries.push(ContextMenuItem::action("Copy Path", CopyPath));
         //         menu_entries.push(ContextMenuItem::action(
-        //             "Search Inside",
-        //             NewSearchInDirectory,
+        //             "Copy Relative Path",
+        //             CopyRelativePath,
         //         ));
-        //     }
 
-        //     menu_entries.push(ContextMenuItem::Separator);
-        //     menu_entries.push(ContextMenuItem::action("Rename", Rename));
-        //     if !is_root {
-        //         menu_entries.push(ContextMenuItem::action("Delete", Delete));
+        //         if entry.is_dir() {
+        //             menu_entries.push(ContextMenuItem::Separator);
+        //         }
+        //         menu_entries.push(ContextMenuItem::action("Reveal in Finder", RevealInFinder));
+        //         if entry.is_dir() {
+        //             menu_entries.push(ContextMenuItem::action("Open in Terminal", OpenInTerminal));
+        //             menu_entries.push(ContextMenuItem::action(
+        //                 "Search Inside",
+        //                 NewSearchInDirectory,
+        //             ));
+        //         }
+
+        //         menu_entries.push(ContextMenuItem::Separator);
+        //         menu_entries.push(ContextMenuItem::action("Rename", Rename));
+        //         if !is_root {
+        //             menu_entries.push(ContextMenuItem::action("Delete", Delete));
+        //         }
         //     }
-        // }
 
-        // // self.context_menu.update(cx, |menu, cx| {
-        // //     menu.show(position, AnchorCorner::TopLeft, menu_entries, cx);
-        // // });
+        //     // self.context_menu.update(cx, |menu, cx| {
+        //     //     menu.show(position, AnchorCorner::TopLeft, menu_entries, cx);
+        //     // });
 
-        // cx.notify();
+        //     cx.notify();
     }
 
     fn expand_selected_entry(&mut self, _: &ExpandSelectedEntry, cx: &mut ViewContext<Self>) {
@@ -579,22 +554,18 @@ impl ProjectPanel {
         }
     }
 
-    fn confirm(&mut self, _: &Confirm, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> {
+    fn confirm(&mut self, _: &Confirm, cx: &mut ViewContext<Self>) {
         if let Some(task) = self.confirm_edit(cx) {
-            return Some(task);
+            task.detach_and_log_err(cx);
         }
-
-        None
     }
 
-    fn open_file(&mut self, _: &Open, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> {
+    fn open_file(&mut self, _: &Open, cx: &mut ViewContext<Self>) {
         if let Some((_, entry)) = self.selected_entry(cx) {
             if entry.is_file() {
                 self.open_entry(entry.id, true, cx);
             }
         }
-
-        None
     }
 
     fn confirm_edit(&mut self, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> {
@@ -800,27 +771,32 @@ impl ProjectPanel {
         }
     }
 
-    fn delete(&mut self, _: &Delete, cx: &mut ViewContext<Self>) -> Option<Task<Result<()>>> {
-        let Selection { entry_id, .. } = self.selection?;
-        let path = self.project.read(cx).path_for_entry(entry_id, cx)?.path;
-        let file_name = path.file_name()?;
-
-        let mut answer = cx.prompt(
-            PromptLevel::Info,
-            &format!("Delete {file_name:?}?"),
-            &["Delete", "Cancel"],
-        );
-        Some(cx.spawn(|this, mut cx| async move {
-            if answer.await != Ok(0) {
-                return Ok(());
-            }
-            this.update(&mut cx, |this, cx| {
-                this.project
-                    .update(cx, |project, cx| project.delete_entry(entry_id, cx))
-                    .ok_or_else(|| anyhow!("no such entry"))
-            })??
-            .await
-        }))
+    fn delete(&mut self, _: &Delete, cx: &mut ViewContext<Self>) {
+        maybe!({
+            let Selection { entry_id, .. } = self.selection?;
+            let path = self.project.read(cx).path_for_entry(entry_id, cx)?.path;
+            let file_name = path.file_name()?;
+
+            let answer = cx.prompt(
+                PromptLevel::Info,
+                &format!("Delete {file_name:?}?"),
+                &["Delete", "Cancel"],
+            );
+
+            cx.spawn(|this, mut cx| async move {
+                if answer.await != Ok(0) {
+                    return Ok(());
+                }
+                this.update(&mut cx, |this, cx| {
+                    this.project
+                        .update(cx, |project, cx| project.delete_entry(entry_id, cx))
+                        .ok_or_else(|| anyhow!("no such entry"))
+                })??
+                .await
+            })
+            .detach_and_log_err(cx);
+            Some(())
+        });
     }
 
     fn select_next(&mut self, _: &SelectNext, cx: &mut ViewContext<Self>) {
@@ -897,8 +873,9 @@ impl ProjectPanel {
         }
     }
 
-    fn paste(&mut self, _: &Paste, cx: &mut ViewContext<Self>) -> Option<()> {
-        if let Some((worktree, entry)) = self.selected_entry(cx) {
+    fn paste(&mut self, _: &Paste, cx: &mut ViewContext<Self>) {
+        maybe!({
+            let (worktree, entry) = self.selected_entry(cx)?;
             let clipboard_entry = self.clipboard_entry?;
             if clipboard_entry.worktree_id() != worktree.id() {
                 return None;
@@ -942,15 +919,16 @@ impl ProjectPanel {
                 if let Some(task) = self.project.update(cx, |project, cx| {
                     project.rename_entry(clipboard_entry.entry_id(), new_path, cx)
                 }) {
-                    task.detach_and_log_err(cx)
+                    task.detach_and_log_err(cx);
                 }
             } else if let Some(task) = self.project.update(cx, |project, cx| {
                 project.copy_entry(clipboard_entry.entry_id(), new_path, cx)
             }) {
-                task.detach_and_log_err(cx)
+                task.detach_and_log_err(cx);
             }
-        }
-        None
+
+            Some(())
+        });
     }
 
     fn copy_path(&mut self, _: &CopyPath, cx: &mut ViewContext<Self>) {
@@ -977,7 +955,7 @@ impl ProjectPanel {
         }
     }
 
-    fn open_in_terminal(&mut self, _: &OpenInTerminal, cx: &mut ViewContext<Self>) {
+    fn open_in_terminal(&mut self, _: &OpenInTerminal, _cx: &mut ViewContext<Self>) {
         todo!()
         // if let Some((worktree, entry)) = self.selected_entry(cx) {
         //     let window = cx.window();
@@ -1012,36 +990,37 @@ impl ProjectPanel {
         }
     }
 
-    fn move_entry(
-        &mut self,
-        entry_to_move: ProjectEntryId,
-        destination: ProjectEntryId,
-        destination_is_file: bool,
-        cx: &mut ViewContext<Self>,
-    ) {
-        let destination_worktree = self.project.update(cx, |project, cx| {
-            let entry_path = project.path_for_entry(entry_to_move, cx)?;
-            let destination_entry_path = project.path_for_entry(destination, cx)?.path.clone();
-
-            let mut destination_path = destination_entry_path.as_ref();
-            if destination_is_file {
-                destination_path = destination_path.parent()?;
-            }
-
-            let mut new_path = destination_path.to_path_buf();
-            new_path.push(entry_path.path.file_name()?);
-            if new_path != entry_path.path.as_ref() {
-                let task = project.rename_entry(entry_to_move, new_path, cx)?;
-                cx.foreground_executor().spawn(task).detach_and_log_err(cx);
-            }
-
-            Some(project.worktree_id_for_entry(destination, cx)?)
-        });
-
-        if let Some(destination_worktree) = destination_worktree {
-            self.expand_entry(destination_worktree, destination, cx);
-        }
-    }
+    // todo!()
+    // fn move_entry(
+    //     &mut self,
+    //     entry_to_move: ProjectEntryId,
+    //     destination: ProjectEntryId,
+    //     destination_is_file: bool,
+    //     cx: &mut ViewContext<Self>,
+    // ) {
+    //     let destination_worktree = self.project.update(cx, |project, cx| {
+    //         let entry_path = project.path_for_entry(entry_to_move, cx)?;
+    //         let destination_entry_path = project.path_for_entry(destination, cx)?.path.clone();
+
+    //         let mut destination_path = destination_entry_path.as_ref();
+    //         if destination_is_file {
+    //             destination_path = destination_path.parent()?;
+    //         }
+
+    //         let mut new_path = destination_path.to_path_buf();
+    //         new_path.push(entry_path.path.file_name()?);
+    //         if new_path != entry_path.path.as_ref() {
+    //             let task = project.rename_entry(entry_to_move, new_path, cx)?;
+    //             cx.foreground_executor().spawn(task).detach_and_log_err(cx);
+    //         }
+
+    //         Some(project.worktree_id_for_entry(destination, cx)?)
+    //     });
+
+    //     if let Some(destination_worktree) = destination_worktree {
+    //         self.expand_entry(destination_worktree, destination, cx);
+    //     }
+    // }
 
     fn index_for_selection(&self, selection: Selection) -> Option<(usize, usize, usize)> {
         let mut entry_index = 0;
@@ -1366,23 +1345,32 @@ impl ProjectPanel {
             .git_status
             .as_ref()
             .map(|status| match status {
-                GitFileStatus::Added => theme.styles.status.created,
-                GitFileStatus::Modified => theme.styles.status.modified,
-                GitFileStatus::Conflict => theme.styles.status.conflict,
+                GitFileStatus::Added => theme.status().created,
+                GitFileStatus::Modified => theme.status().modified,
+                GitFileStatus::Conflict => theme.status().conflict,
             })
-            .unwrap_or(theme.styles.status.info);
+            .unwrap_or(theme.status().info);
 
         h_stack()
             .child(if let Some(icon) = &details.icon {
-                div().child(svg().path(icon.to_string()))
+                div().child(
+                    // todo!() Marshall: Can we use our `IconElement` component here?
+                    svg()
+                        .size(rems(0.9375))
+                        .flex_none()
+                        .path(icon.to_string())
+                        .text_color(cx.theme().colors().icon),
+                )
             } else {
                 div()
             })
             .child(
                 if let (Some(editor), true) = (editor, show_editor) {
-                    div().child(editor.clone())
+                    div().w_full().child(editor.clone())
                 } else {
-                    div().child(details.filename.clone())
+                    div()
+                        .text_color(filename_text_color)
+                        .child(Label::new(details.filename.clone()))
                 }
                 .ml_1(),
             )
@@ -1390,11 +1378,10 @@ impl ProjectPanel {
     }
 
     fn render_entry(
+        &self,
         entry_id: ProjectEntryId,
         details: EntryDetails,
-        editor: &View<Editor>,
         // dragged_entry_destination: &mut Option<Arc<Path>>,
-        // theme: &theme::ProjectPanel,
         cx: &mut ViewContext<Self>,
     ) -> Div<Self, StatefulInteractivity<Self>> {
         let kind = details.kind;
@@ -1402,9 +1389,18 @@ impl ProjectPanel {
         const INDENT_SIZE: Pixels = px(16.0);
         let padding = INDENT_SIZE + details.depth as f32 * px(settings.indent_size);
         let show_editor = details.is_editing && !details.is_processing;
+        let is_selected = self
+            .selection
+            .map_or(false, |selection| selection.entry_id == entry_id);
 
-        Self::render_entry_visual_element(&details, Some(editor), padding, cx)
+        Self::render_entry_visual_element(&details, Some(&self.filename_editor), padding, cx)
             .id(entry_id.to_proto() as usize)
+            .w_full()
+            .cursor_pointer()
+            .when(is_selected, |this| {
+                this.bg(cx.theme().colors().element_selected)
+            })
+            .hover(|style| style.bg(cx.theme().colors().element_hover))
             .on_click(move |this, event, cx| {
                 if !show_editor {
                     if kind.is_dir() {
@@ -1418,38 +1414,51 @@ impl ProjectPanel {
                     }
                 }
             })
-        // .on_down(MouseButton::Right, move |event, this, cx| {
-        //     this.deploy_context_menu(event.position, entry_id, cx);
-        // })
-        // .on_up(MouseButton::Left, move |_, this, cx| {
-        // if let Some((_, dragged_entry)) = cx
-        //     .global::<DragAndDrop<Workspace>>()
-        //     .currently_dragged::<ProjectEntryId>(cx.window())
-        // {
+            .on_mouse_down(MouseButton::Right, move |this, event, cx| {
+                this.deploy_context_menu(event.position, entry_id, cx);
+            })
+        // .on_drop::<ProjectEntryId>(|this, event, cx| {
         //     this.move_entry(
         //         *dragged_entry,
         //         entry_id,
         //         matches!(details.kind, EntryKind::File(_)),
         //         cx,
         //     );
-        // }
         // })
     }
 }
 
 impl Render for ProjectPanel {
-    type Element = Div<Self, StatefulInteractivity<Self>, FocusEnabled<Self>>;
-
-    fn render(&mut self, cx: &mut gpui::ViewContext<Self>) -> Self::Element {
-        enum ProjectPanel {}
-        let theme = cx.theme();
-        let last_worktree_root_id = self.last_worktree_root_id;
+    type Element = Div<Self, StatefulInteractivity<Self>, FocusableKeyDispatch<Self>>;
 
+    fn render(&mut self, _cx: &mut gpui::ViewContext<Self>) -> Self::Element {
         let has_worktree = self.visible_entries.len() != 0;
 
         if has_worktree {
             div()
                 .id("project-panel")
+                .size_full()
+                .context("ProjectPanel")
+                .on_action(Self::select_next)
+                .on_action(Self::select_prev)
+                .on_action(Self::expand_selected_entry)
+                .on_action(Self::collapse_selected_entry)
+                .on_action(Self::collapse_all_entries)
+                .on_action(Self::new_file)
+                .on_action(Self::new_directory)
+                .on_action(Self::rename)
+                .on_action(Self::delete)
+                .on_action(Self::confirm)
+                .on_action(Self::open_file)
+                .on_action(Self::cancel)
+                .on_action(Self::cut)
+                .on_action(Self::copy)
+                .on_action(Self::copy_path)
+                .on_action(Self::copy_relative_path)
+                .on_action(Self::paste)
+                .on_action(Self::reveal_in_finder)
+                .on_action(Self::open_in_terminal)
+                .on_action(Self::new_search_in_directory)
                 .track_focus(&self.focus_handle)
                 .child(
                     uniform_list(
@@ -1461,17 +1470,12 @@ impl Render for ProjectPanel {
                         |this: &mut Self, range, cx| {
                             let mut items = SmallVec::new();
                             this.for_each_visible_entry(range, cx, |id, details, cx| {
-                                items.push(Self::render_entry(
-                                    id,
-                                    details,
-                                    &this.filename_editor,
-                                    // &mut dragged_entry_destination,
-                                    cx,
-                                ));
+                                items.push(this.render_entry(id, details, cx));
                             });
                             items
                         },
                     )
+                    .size_full()
                     .track_scroll(self.list.clone()),
                 )
         } else {

crates/project_panel2/src/project_panel_settings.rs 🔗

@@ -0,0 +1,45 @@
+use anyhow;
+use schemars::JsonSchema;
+use serde_derive::{Deserialize, Serialize};
+use settings::Settings;
+
+#[derive(Clone, Debug, Serialize, Deserialize, JsonSchema)]
+#[serde(rename_all = "snake_case")]
+pub enum ProjectPanelDockPosition {
+    Left,
+    Right,
+}
+
+#[derive(Deserialize, Debug)]
+pub struct ProjectPanelSettings {
+    pub default_width: f32,
+    pub dock: ProjectPanelDockPosition,
+    pub file_icons: bool,
+    pub folder_icons: bool,
+    pub git_status: bool,
+    pub indent_size: f32,
+}
+
+#[derive(Clone, Default, Serialize, Deserialize, JsonSchema, Debug)]
+pub struct ProjectPanelSettingsContent {
+    pub default_width: Option<f32>,
+    pub dock: Option<ProjectPanelDockPosition>,
+    pub file_icons: Option<bool>,
+    pub folder_icons: Option<bool>,
+    pub git_status: Option<bool>,
+    pub indent_size: Option<f32>,
+}
+
+impl Settings for ProjectPanelSettings {
+    const KEY: Option<&'static str> = Some("project_panel");
+
+    type FileContent = ProjectPanelSettingsContent;
+
+    fn load(
+        default_value: &Self::FileContent,
+        user_values: &[&Self::FileContent],
+        _: &mut gpui::AppContext,
+    ) -> anyhow::Result<Self> {
+        Self::load_via_json_merge(default_value, user_values)
+    }
+}

crates/settings2/src/keymap_file.rs 🔗

@@ -9,7 +9,7 @@ use schemars::{
 };
 use serde::Deserialize;
 use serde_json::Value;
-use util::{asset_str, ResultExt};
+use util::asset_str;
 
 #[derive(Debug, Deserialize, Default, Clone, JsonSchema)]
 #[serde(transparent)]
@@ -86,7 +86,9 @@ impl KeymapFile {
                             "invalid binding value for keystroke {keystroke}, context {context:?}"
                         )
                     })
-                    .log_err()
+                    // todo!()
+                    .ok()
+                    // .log_err()
                     .map(|action| KeyBinding::load(&keystroke, action, context.as_deref()))
                 })
                 .collect::<Result<Vec<_>>>()?;

crates/workspace2/src/dock.rs 🔗

@@ -1,7 +1,7 @@
 use crate::{status_bar::StatusItemView, Axis, Workspace};
 use gpui::{
-    div, Action, AnyView, AppContext, Div, Entity, EntityId, EventEmitter, ParentElement, Render,
-    Subscription, View, ViewContext, WeakView, WindowContext,
+    div, Action, AnyView, AppContext, Div, Entity, EntityId, EventEmitter, FocusHandle,
+    ParentElement, Render, Styled, Subscription, View, ViewContext, WeakView, WindowContext,
 };
 use schemars::JsonSchema;
 use serde::{Deserialize, Serialize};
@@ -34,6 +34,7 @@ pub trait Panel: Render + EventEmitter<PanelEvent> {
     fn set_zoomed(&mut self, _zoomed: bool, _cx: &mut ViewContext<Self>) {}
     fn set_active(&mut self, _active: bool, _cx: &mut ViewContext<Self>) {}
     fn has_focus(&self, cx: &WindowContext) -> bool;
+    fn focus_handle(&self, cx: &WindowContext) -> FocusHandle;
 }
 
 pub trait PanelHandle: Send + Sync {
@@ -51,6 +52,7 @@ pub trait PanelHandle: Send + Sync {
     fn icon_tooltip(&self, cx: &WindowContext) -> (String, Option<Box<dyn Action>>);
     fn icon_label(&self, cx: &WindowContext) -> Option<String>;
     fn has_focus(&self, cx: &WindowContext) -> bool;
+    fn focus_handle(&self, cx: &WindowContext) -> FocusHandle;
     fn to_any(&self) -> AnyView;
 }
 
@@ -117,6 +119,10 @@ where
     fn to_any(&self) -> AnyView {
         self.clone().into()
     }
+
+    fn focus_handle(&self, cx: &WindowContext) -> FocusHandle {
+        self.read(cx).focus_handle(cx).clone()
+    }
 }
 
 impl From<&dyn PanelHandle> for AnyView {
@@ -422,7 +428,11 @@ impl Render for Dock {
     type Element = Div<Self>;
 
     fn render(&mut self, cx: &mut ViewContext<Self>) -> Self::Element {
-        todo!()
+        if let Some(entry) = self.visible_entry() {
+            div().size_full().child(entry.panel.to_any())
+        } else {
+            div()
+        }
     }
 }
 
@@ -728,5 +738,9 @@ pub mod test {
         fn has_focus(&self, _cx: &WindowContext) -> bool {
             self.has_focus
         }
+
+        fn focus_handle(&self, cx: &WindowContext) -> FocusHandle {
+            unimplemented!()
+        }
     }
 }

crates/workspace2/src/workspace2.rs 🔗

@@ -29,7 +29,7 @@ use client2::{
     Client, TypedEnvelope, UserStore,
 };
 use collections::{hash_map, HashMap, HashSet};
-use dock::{Dock, DockPosition, PanelButtons};
+use dock::{Dock, DockPosition, Panel, PanelButtons, PanelHandle as _};
 use futures::{
     channel::{mpsc, oneshot},
     future::try_join_all,
@@ -248,102 +248,6 @@ pub fn init(app_state: Arc<AppState>, cx: &mut AppContext) {
     //             }
     //         }
     //     });
-    //     cx.add_async_action(Workspace::open);
-
-    //     cx.add_async_action(Workspace::follow_next_collaborator);
-    //     cx.add_async_action(Workspace::close);
-    //     cx.add_async_action(Workspace::close_inactive_items_and_panes);
-    //     cx.add_async_action(Workspace::close_all_items_and_panes);
-    //     cx.add_global_action(Workspace::close_global);
-    //     cx.add_global_action(restart);
-    //     cx.add_async_action(Workspace::save_all);
-    //     cx.add_action(Workspace::add_folder_to_project);
-    //     cx.add_action(
-    //         |workspace: &mut Workspace, _: &Unfollow, cx: &mut ViewContext<Workspace>| {
-    //             let pane = workspace.active_pane().clone();
-    //             workspace.unfollow(&pane, cx);
-    //         },
-    //     );
-    //     cx.add_action(
-    //         |workspace: &mut Workspace, action: &Save, cx: &mut ViewContext<Workspace>| {
-    //             workspace
-    //                 .save_active_item(action.save_intent.unwrap_or(SaveIntent::Save), cx)
-    //                 .detach_and_log_err(cx);
-    //         },
-    //     );
-    //     cx.add_action(
-    //         |workspace: &mut Workspace, _: &SaveAs, cx: &mut ViewContext<Workspace>| {
-    //             workspace
-    //                 .save_active_item(SaveIntent::SaveAs, cx)
-    //                 .detach_and_log_err(cx);
-    //         },
-    //     );
-    //     cx.add_action(|workspace: &mut Workspace, _: &ActivatePreviousPane, cx| {
-    //         workspace.activate_previous_pane(cx)
-    //     });
-    //     cx.add_action(|workspace: &mut Workspace, _: &ActivateNextPane, cx| {
-    //         workspace.activate_next_pane(cx)
-    //     });
-
-    //     cx.add_action(
-    //         |workspace: &mut Workspace, action: &ActivatePaneInDirection, cx| {
-    //             workspace.activate_pane_in_direction(action.0, cx)
-    //         },
-    //     );
-
-    //     cx.add_action(
-    //         |workspace: &mut Workspace, action: &SwapPaneInDirection, cx| {
-    //             workspace.swap_pane_in_direction(action.0, cx)
-    //         },
-    //     );
-
-    //     cx.add_action(|workspace: &mut Workspace, _: &ToggleLeftDock, cx| {
-    //         workspace.toggle_dock(DockPosition::Left, cx);
-    //     });
-    //     cx.add_action(|workspace: &mut Workspace, _: &ToggleRightDock, cx| {
-    //         workspace.toggle_dock(DockPosition::Right, cx);
-    //     });
-    //     cx.add_action(|workspace: &mut Workspace, _: &ToggleBottomDock, cx| {
-    //         workspace.toggle_dock(DockPosition::Bottom, cx);
-    //     });
-    //     cx.add_action(|workspace: &mut Workspace, _: &CloseAllDocks, cx| {
-    //         workspace.close_all_docks(cx);
-    //     });
-    //     cx.add_action(Workspace::activate_pane_at_index);
-    //     cx.add_action(|workspace: &mut Workspace, _: &ReopenClosedItem, cx| {
-    //         workspace.reopen_closed_item(cx).detach();
-    //     });
-    //     cx.add_action(|workspace: &mut Workspace, _: &GoBack, cx| {
-    //         workspace
-    //             .go_back(workspace.active_pane().downgrade(), cx)
-    //             .detach();
-    //     });
-    //     cx.add_action(|workspace: &mut Workspace, _: &GoForward, cx| {
-    //         workspace
-    //             .go_forward(workspace.active_pane().downgrade(), cx)
-    //             .detach();
-    //     });
-
-    //     cx.add_action(|_: &mut Workspace, _: &install_cli::Install, cx| {
-    //         cx.spawn(|workspace, mut cx| async move {
-    //             let err = install_cli::install_cli(&cx)
-    //                 .await
-    //                 .context("Failed to create CLI symlink");
-
-    //             workspace.update(&mut cx, |workspace, cx| {
-    //                 if matches!(err, Err(_)) {
-    //                     err.notify_err(workspace, cx);
-    //                 } else {
-    //                     workspace.show_notification(1, cx, |cx| {
-    //                         cx.build_view(|_| {
-    //                             MessageNotification::new("Successfully installed the `zed` binary")
-    //                         })
-    //                     });
-    //                 }
-    //             })
-    //         })
-    //         .detach();
-    //     });
 }
 
 type ProjectItemBuilders =
@@ -942,108 +846,15 @@ impl Workspace {
         &self.right_dock
     }
 
-    //     pub fn add_panel<T: Panel>(&mut self, panel: View<T>, cx: &mut ViewContext<Self>)
-    //     where
-    //         T::Event: std::fmt::Debug,
-    //     {
-    //         self.add_panel_with_extra_event_handler(panel, cx, |_, _, _, _| {})
-    //     }
-
-    //     pub fn add_panel_with_extra_event_handler<T: Panel, F>(
-    //         &mut self,
-    //         panel: View<T>,
-    //         cx: &mut ViewContext<Self>,
-    //         handler: F,
-    //     ) where
-    //         T::Event: std::fmt::Debug,
-    //         F: Fn(&mut Self, &View<T>, &T::Event, &mut ViewContext<Self>) + 'static,
-    //     {
-    //         let dock = match panel.position(cx) {
-    //             DockPosition::Left => &self.left_dock,
-    //             DockPosition::Bottom => &self.bottom_dock,
-    //             DockPosition::Right => &self.right_dock,
-    //         };
-
-    //         self.subscriptions.push(cx.subscribe(&panel, {
-    //             let mut dock = dock.clone();
-    //             let mut prev_position = panel.position(cx);
-    //             move |this, panel, event, cx| {
-    //                 if T::should_change_position_on_event(event) {
-    //                     THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
-    //                     See: Dock::add_panel
-    //
-    //                     let new_position = panel.read(cx).position(cx);
-    //                     let mut was_visible = false;
-    //                     dock.update(cx, |dock, cx| {
-    //                         prev_position = new_position;
-
-    //                         was_visible = dock.is_open()
-    //                             && dock
-    //                                 .visible_panel()
-    //                                 .map_or(false, |active_panel| active_panel.id() == panel.id());
-    //                         dock.remove_panel(&panel, cx);
-    //                     });
-
-    //                     if panel.is_zoomed(cx) {
-    //                         this.zoomed_position = Some(new_position);
-    //                     }
-
-    //                     dock = match panel.read(cx).position(cx) {
-    //                         DockPosition::Left => &this.left_dock,
-    //                         DockPosition::Bottom => &this.bottom_dock,
-    //                         DockPosition::Right => &this.right_dock,
-    //                     }
-    //                     .clone();
-    //                     dock.update(cx, |dock, cx| {
-    //                         dock.add_panel(panel.clone(), cx);
-    //                         if was_visible {
-    //                             dock.set_open(true, cx);
-    //                             dock.activate_panel(dock.panels_len() - 1, cx);
-    //                         }
-    //                     });
-    //                 } else if T::should_zoom_in_on_event(event) {
-    //                     THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
-    //                     See: Dock::add_panel
-    //
-    //                     dock.update(cx, |dock, cx| dock.set_panel_zoomed(&panel, true, cx));
-    //                     if !panel.has_focus(cx) {
-    //                         cx.focus(&panel);
-    //                     }
-    //                     this.zoomed = Some(panel.downgrade().into_any());
-    //                     this.zoomed_position = Some(panel.read(cx).position(cx));
-    //                 } else if T::should_zoom_out_on_event(event) {
-    //                     THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
-    //                     See: Dock::add_panel
-    //
-    //                     dock.update(cx, |dock, cx| dock.set_panel_zoomed(&panel, false, cx));
-    //                     if this.zoomed_position == Some(prev_position) {
-    //                         this.zoomed = None;
-    //                         this.zoomed_position = None;
-    //                     }
-    //                     cx.notify();
-    //                 } else if T::is_focus_event(event) {
-    //                     THIS HAS BEEN MOVED TO NORMAL EVENT EMISSION
-    //                     See: Dock::add_panel
-    //
-    //                     let position = panel.read(cx).position(cx);
-    //                     this.dismiss_zoomed_items_to_reveal(Some(position), cx);
-    //                     if panel.is_zoomed(cx) {
-    //                         this.zoomed = Some(panel.downgrade().into_any());
-    //                         this.zoomed_position = Some(position);
-    //                     } else {
-    //                         this.zoomed = None;
-    //                         this.zoomed_position = None;
-    //                     }
-    //                     this.update_active_view_for_followers(cx);
-    //                     cx.notify();
-    //                 } else {
-    //                     handler(this, &panel, event, cx)
-    //                 }
-    //             }
-    //         }));
+    pub fn add_panel<T: Panel>(&mut self, panel: View<T>, cx: &mut ViewContext<Self>) {
+        let dock = match panel.position(cx) {
+            DockPosition::Left => &self.left_dock,
+            DockPosition::Bottom => &self.bottom_dock,
+            DockPosition::Right => &self.right_dock,
+        };
 
-    //         dock.update(cx, |dock, cx| dock.add_panel(panel, cx));
-    //     }
+        dock.update(cx, |dock, cx| dock.add_panel(panel, cx));
+    }
 
     pub fn status_bar(&self) -> &View<StatusBar> {
         &self.status_bar
@@ -1735,42 +1546,43 @@ impl Workspace {
     //         }
     //     }
 
-    //     pub fn toggle_dock(&mut self, dock_side: DockPosition, cx: &mut ViewContext<Self>) {
-    //         let dock = match dock_side {
-    //             DockPosition::Left => &self.left_dock,
-    //             DockPosition::Bottom => &self.bottom_dock,
-    //             DockPosition::Right => &self.right_dock,
-    //         };
-    //         let mut focus_center = false;
-    //         let mut reveal_dock = false;
-    //         dock.update(cx, |dock, cx| {
-    //             let other_is_zoomed = self.zoomed.is_some() && self.zoomed_position != Some(dock_side);
-    //             let was_visible = dock.is_open() && !other_is_zoomed;
-    //             dock.set_open(!was_visible, cx);
-
-    //             if let Some(active_panel) = dock.active_panel() {
-    //                 if was_visible {
-    //                     if active_panel.has_focus(cx) {
-    //                         focus_center = true;
-    //                     }
-    //                 } else {
-    //                     cx.focus(active_panel.as_any());
-    //                     reveal_dock = true;
-    //                 }
-    //             }
-    //         });
+    pub fn toggle_dock(&mut self, dock_side: DockPosition, cx: &mut ViewContext<Self>) {
+        let dock = match dock_side {
+            DockPosition::Left => &self.left_dock,
+            DockPosition::Bottom => &self.bottom_dock,
+            DockPosition::Right => &self.right_dock,
+        };
+        let mut focus_center = false;
+        let mut reveal_dock = false;
+        dock.update(cx, |dock, cx| {
+            let other_is_zoomed = self.zoomed.is_some() && self.zoomed_position != Some(dock_side);
+            let was_visible = dock.is_open() && !other_is_zoomed;
+            dock.set_open(!was_visible, cx);
+
+            if let Some(active_panel) = dock.active_panel() {
+                if was_visible {
+                    if active_panel.has_focus(cx) {
+                        focus_center = true;
+                    }
+                } else {
+                    let focus_handle = &active_panel.focus_handle(cx);
+                    cx.focus(focus_handle);
+                    reveal_dock = true;
+                }
+            }
+        });
 
-    //         if reveal_dock {
-    //             self.dismiss_zoomed_items_to_reveal(Some(dock_side), cx);
-    //         }
+        if reveal_dock {
+            self.dismiss_zoomed_items_to_reveal(Some(dock_side), cx);
+        }
 
-    //         if focus_center {
-    //             cx.focus_self();
-    //         }
+        if focus_center {
+            cx.focus(&self.focus_handle);
+        }
 
-    //         cx.notify();
-    //         self.serialize_workspace(cx);
-    //     }
+        cx.notify();
+        self.serialize_workspace(cx);
+    }
 
     pub fn close_all_docks(&mut self, cx: &mut ViewContext<Self>) {
         let docks = [&self.left_dock, &self.bottom_dock, &self.right_dock];
@@ -3467,6 +3279,107 @@ impl Workspace {
         })
     }
 
+    fn actions(div: Div<Self>) -> Div<Self> {
+        div
+            //     cx.add_async_action(Workspace::open);
+            //     cx.add_async_action(Workspace::follow_next_collaborator);
+            //     cx.add_async_action(Workspace::close);
+            //     cx.add_async_action(Workspace::close_inactive_items_and_panes);
+            //     cx.add_async_action(Workspace::close_all_items_and_panes);
+            //     cx.add_global_action(Workspace::close_global);
+            //     cx.add_global_action(restart);
+            //     cx.add_async_action(Workspace::save_all);
+            //     cx.add_action(Workspace::add_folder_to_project);
+            //     cx.add_action(
+            //         |workspace: &mut Workspace, _: &Unfollow, cx: &mut ViewContext<Workspace>| {
+            //             let pane = workspace.active_pane().clone();
+            //             workspace.unfollow(&pane, cx);
+            //         },
+            //     );
+            //     cx.add_action(
+            //         |workspace: &mut Workspace, action: &Save, cx: &mut ViewContext<Workspace>| {
+            //             workspace
+            //                 .save_active_item(action.save_intent.unwrap_or(SaveIntent::Save), cx)
+            //                 .detach_and_log_err(cx);
+            //         },
+            //     );
+            //     cx.add_action(
+            //         |workspace: &mut Workspace, _: &SaveAs, cx: &mut ViewContext<Workspace>| {
+            //             workspace
+            //                 .save_active_item(SaveIntent::SaveAs, cx)
+            //                 .detach_and_log_err(cx);
+            //         },
+            //     );
+            //     cx.add_action(|workspace: &mut Workspace, _: &ActivatePreviousPane, cx| {
+            //         workspace.activate_previous_pane(cx)
+            //     });
+            //     cx.add_action(|workspace: &mut Workspace, _: &ActivateNextPane, cx| {
+            //         workspace.activate_next_pane(cx)
+            //     });
+            //     cx.add_action(
+            //         |workspace: &mut Workspace, action: &ActivatePaneInDirection, cx| {
+            //             workspace.activate_pane_in_direction(action.0, cx)
+            //         },
+            //     );
+            //     cx.add_action(
+            //         |workspace: &mut Workspace, action: &SwapPaneInDirection, cx| {
+            //             workspace.swap_pane_in_direction(action.0, cx)
+            //         },
+            //     );
+            .on_action(|this, e: &ToggleLeftDock, cx| {
+                println!("TOGGLING DOCK");
+                this.toggle_dock(DockPosition::Left, cx);
+            })
+        //     cx.add_action(|workspace: &mut Workspace, _: &ToggleRightDock, cx| {
+        //         workspace.toggle_dock(DockPosition::Right, cx);
+        //     });
+        //     cx.add_action(|workspace: &mut Workspace, _: &ToggleBottomDock, cx| {
+        //         workspace.toggle_dock(DockPosition::Bottom, cx);
+        //     });
+        //     cx.add_action(|workspace: &mut Workspace, _: &CloseAllDocks, cx| {
+        //         workspace.close_all_docks(cx);
+        //     });
+        //     cx.add_action(Workspace::activate_pane_at_index);
+        //     cx.add_action(|workspace: &mut Workspace, _: &ReopenClosedItem, cx| {
+        //         workspace.reopen_closed_item(cx).detach();
+        //     });
+        //     cx.add_action(|workspace: &mut Workspace, _: &GoBack, cx| {
+        //         workspace
+        //             .go_back(workspace.active_pane().downgrade(), cx)
+        //             .detach();
+        //     });
+        //     cx.add_action(|workspace: &mut Workspace, _: &GoForward, cx| {
+        //         workspace
+        //             .go_forward(workspace.active_pane().downgrade(), cx)
+        //             .detach();
+        //     });
+
+        //     cx.add_action(|_: &mut Workspace, _: &install_cli::Install, cx| {
+        //         cx.spawn(|workspace, mut cx| async move {
+        //             let err = install_cli::install_cli(&cx)
+        //                 .await
+        //                 .context("Failed to create CLI symlink");
+
+        //             workspace.update(&mut cx, |workspace, cx| {
+        //                 if matches!(err, Err(_)) {
+        //                     err.notify_err(workspace, cx);
+        //                 } else {
+        //                     workspace.show_notification(1, cx, |cx| {
+        //                         cx.build_view(|_| {
+        //                             MessageNotification::new("Successfully installed the `zed` binary")
+        //                         })
+        //                     });
+        //                 }
+        //             })
+        //         })
+        //         .detach();
+        //     });
+    }
+
+    // todo!()
+    //     #[cfg(any(test, feature = "test-support"))]
+    //     pub fn test_new(project: ModelHandle<Project>, cx: &mut ViewContext<Self>) -> Self {
+    //         use node_runtime::FakeNodeRuntime;
     #[cfg(any(test, feature = "test-support"))]
     pub fn test_new(project: Model<Project>, cx: &mut ViewContext<Self>) -> Self {
         use gpui::Context;
@@ -3791,83 +3704,31 @@ impl Render for Workspace {
                     .border_b()
                     .border_color(cx.theme().colors().border)
                     .child(self.modal_layer.clone())
-                    // .children(
-                    //     Some(
-                    //         Panel::new("project-panel-outer", cx)
-                    //             .side(PanelSide::Left)
-                    //             .child(ProjectPanel::new("project-panel-inner")),
-                    //     )
-                    //     .filter(|_| self.is_project_panel_open()),
-                    // )
-                    // .children(
-                    //     Some(
-                    //         Panel::new("collab-panel-outer", cx)
-                    //             .child(CollabPanel::new("collab-panel-inner"))
-                    //             .side(PanelSide::Left),
-                    //     )
-                    //     .filter(|_| self.is_collab_panel_open()),
-                    // )
-                    // .child(NotificationToast::new(
-                    //     "maxbrunsfeld has requested to add you as a contact.".into(),
-                    // ))
                     .child(
-                        div().flex().flex_col().flex_1().h_full().child(
-                            div().flex().flex_1().child(self.center.render(
-                                &self.project,
-                                &self.follower_states,
-                                self.active_call(),
-                                &self.active_pane,
-                                self.zoomed.as_ref(),
-                                &self.app_state,
-                                cx,
-                            )),
-                        ), // .children(
-                           //     Some(
-                           //         Panel::new("terminal-panel", cx)
-                           //             .child(Terminal::new())
-                           //             .allowed_sides(PanelAllowedSides::BottomOnly)
-                           //             .side(PanelSide::Bottom),
-                           //     )
-                           //     .filter(|_| self.is_terminal_open()),
-                           // ),
-                    ), // .children(
-                       //     Some(
-                       //         Panel::new("chat-panel-outer", cx)
-                       //             .side(PanelSide::Right)
-                       //             .child(ChatPanel::new("chat-panel-inner").messages(vec![
-                       //                 ChatMessage::new(
-                       //                     "osiewicz".to_string(),
-                       //                     "is this thing on?".to_string(),
-                       //                     DateTime::parse_from_rfc3339("2023-09-27T15:40:52.707Z")
-                       //                         .unwrap()
-                       //                         .naive_local(),
-                       //                 ),
-                       //                 ChatMessage::new(
-                       //                     "maxdeviant".to_string(),
-                       //                     "Reading you loud and clear!".to_string(),
-                       //                     DateTime::parse_from_rfc3339("2023-09-28T15:40:52.707Z")
-                       //                         .unwrap()
-                       //                         .naive_local(),
-                       //                 ),
-                       //             ])),
-                       //     )
-                       //     .filter(|_| self.is_chat_panel_open()),
-                       // )
-                       // .children(
-                       //     Some(
-                       //         Panel::new("notifications-panel-outer", cx)
-                       //             .side(PanelSide::Right)
-                       //             .child(NotificationsPanel::new("notifications-panel-inner")),
-                       //     )
-                       //     .filter(|_| self.is_notifications_panel_open()),
-                       // )
-                       // .children(
-                       //     Some(
-                       //         Panel::new("assistant-panel-outer", cx)
-                       //             .child(AssistantPanel::new("assistant-panel-inner")),
-                       //     )
-                       //     .filter(|_| self.is_assistant_panel_open()),
-                       // ),
+                        div()
+                            .flex()
+                            .flex_row()
+                            .flex_1()
+                            .h_full()
+                            .child(div().flex().flex_1().child(self.left_dock.clone()))
+                            .child(
+                                div()
+                                    .flex()
+                                    .flex_col()
+                                    .flex_1()
+                                    .child(self.center.render(
+                                        &self.project,
+                                        &self.follower_states,
+                                        self.active_call(),
+                                        &self.active_pane,
+                                        self.zoomed.as_ref(),
+                                        &self.app_state,
+                                        cx,
+                                    ))
+                                    .child(div().flex().flex_1().child(self.bottom_dock.clone())),
+                            )
+                            .child(div().flex().flex_1().child(self.right_dock.clone())),
+                    ),
             )
             .child(self.status_bar.clone())
             // .when(self.debug.show_toast, |this| {

crates/zed2/Cargo.toml 🔗

@@ -55,7 +55,7 @@ node_runtime = { path = "../node_runtime" }
 # outline = { path = "../outline" }
 # plugin_runtime = { path = "../plugin_runtime",optional = true }
 project = { package = "project2", path = "../project2" }
-# project_panel = { path = "../project_panel" }
+project_panel = { package = "project_panel2", path = "../project_panel2" }
 # project_symbols = { path = "../project_symbols" }
 # quick_action_bar = { path = "../quick_action_bar" }
 # recent_projects = { path = "../recent_projects" }

crates/zed2/src/main.rs 🔗

@@ -189,7 +189,7 @@ fn main() {
         // file_finder::init(cx);
         // outline::init(cx);
         // project_symbols::init(cx);
-        // project_panel::init(Assets, cx);
+        project_panel::init(Assets, cx);
         // channel::init(&client, user_store.clone(), cx);
         // diagnostics::init(cx);
         // search::init(cx);

crates/zed2/src/zed2.rs 🔗

@@ -15,9 +15,10 @@ pub use only_instance::*;
 pub use open_listener::*;
 
 use anyhow::Result;
+use project_panel::ProjectPanel;
 use std::sync::Arc;
 use uuid::Uuid;
-use workspace::{AppState, Workspace};
+use workspace::{dock::PanelHandle as _, AppState, Workspace};
 
 pub fn build_window_options(
     bounds: Option<WindowBounds>,
@@ -138,49 +139,38 @@ pub fn initialize_workspace(
             //         }
             //         false
             //     });
-            // })?;
-
-            // let project_panel = ProjectPanel::load(workspace_handle.clone(), cx.clone());
-            // let terminal_panel = TerminalPanel::load(workspace_handle.clone(), cx.clone());
-            // let assistant_panel = AssistantPanel::load(workspace_handle.clone(), cx.clone());
-            // let channels_panel =
-            //     collab_ui::collab_panel::CollabPanel::load(workspace_handle.clone(), cx.clone());
-            // let chat_panel =
-            //     collab_ui::chat_panel::ChatPanel::load(workspace_handle.clone(), cx.clone());
-            // let notification_panel = collab_ui::notification_panel::NotificationPanel::load(
-            //     workspace_handle.clone(),
-            //     cx.clone(),
-            // );
-            // let (
-            //     project_panel,
+        })?;
+
+        let project_panel = ProjectPanel::load(workspace_handle.clone(), cx.clone());
+        // let terminal_panel = TerminalPanel::load(workspace_handle.clone(), cx.clone());
+        // let assistant_panel = AssistantPanel::load(workspace_handle.clone(), cx.clone());
+        // let channels_panel =
+        //     collab_ui::collab_panel::CollabPanel::load(workspace_handle.clone(), cx.clone());
+        // let chat_panel =
+        //     collab_ui::chat_panel::ChatPanel::load(workspace_handle.clone(), cx.clone());
+        // let notification_panel = collab_ui::notification_panel::NotificationPanel::load(
+        //     workspace_handle.clone(),
+        //     cx.clone(),
+        // );
+        let (
+            project_panel,
             //     terminal_panel,
             //     assistant_panel,
             //     channels_panel,
             //     chat_panel,
             //     notification_panel,
-            // ) = futures::try_join!(
-            //     project_panel,
+        ) = futures::try_join!(
+            project_panel,
             //     terminal_panel,
             //     assistant_panel,
             //     channels_panel,
             //     chat_panel,
             //     notification_panel,
-            // )?;
-            // workspace_handle.update(&mut cx, |workspace, cx| {
-            //     let project_panel_position = project_panel.position(cx);
-            //     workspace.add_panel_with_extra_event_handler(
-            //         project_panel,
-            //         cx,
-            //         |workspace, _, event, cx| match event {
-            //             project_panel::Event::NewSearchInDirectory { dir_entry } => {
-            //                 search::ProjectSearchView::new_search_in_directory(workspace, dir_entry, cx)
-            //             }
-            //             project_panel::Event::ActivatePanel => {
-            //                 workspace.focus_panel::<ProjectPanel>(cx);
-            //             }
-            //             _ => {}
-            //         },
-            //     );
+        )?;
+
+        workspace_handle.update(&mut cx, |workspace, cx| {
+            let project_panel_position = project_panel.position(cx);
+            workspace.add_panel(project_panel, cx);
             //     workspace.add_panel(terminal_panel, cx);
             //     workspace.add_panel(assistant_panel, cx);
             //     workspace.add_panel(channels_panel, cx);
@@ -198,9 +188,9 @@ pub fn initialize_workspace(
             //                     .map_or(false, |entry| entry.is_dir())
             //             })
             //     {
-            //         workspace.toggle_dock(project_panel_position, cx);
+            workspace.toggle_dock(project_panel_position, cx);
             //     }
-            //     cx.focus_self();
+            // cx.focus_self();
         })?;
         Ok(())
     })